C24H30FNO3S — CID 54536292
4-benzylsulfinyl-1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]azetidin-2-one (PubChem CID 54536292) has the molecular formula C24H30FNO3S and a molecular weight of 431.57 g/mol. Its IUPAC name is 4-benzylsulfinyl-1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]azetidin-2-one.
| Compound Name | 4-benzylsulfinyl-1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]azetidin-2-one |
|---|---|
| PubChem CID | 54536292 |
| Molecular Formula | C24H30FNO3S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-benzylsulfinyl-1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]azetidin-2-one |
| SMILES | O=C1CC(S(=O)Cc2ccccc2)N1CCOCCCCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H30FNO3S/c25-22-13-11-20(12-14-22)8-4-1-2-7-16-29-17-15-26-23(27)18-24(26)30(28)19-21-9-5-3-6-10-21/h3,5-6,9-14,24H,1-2,4,7-8,15-19H2 |
| InChIKey | YZZXEJNGYFODMK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|