C18H24FNO3S — CID 54089051
6-(4-fluorophenyl)hexyl 2-(2-methylsulfanyl-4-oxoazetidin-1-yl)acetate (PubChem CID 54089051) has the molecular formula C18H24FNO3S and a molecular weight of 353.46 g/mol. Its IUPAC name is 6-(4-fluorophenyl)hexyl 2-(2-methylsulfanyl-4-oxoazetidin-1-yl)acetate.
| Compound Name | 6-(4-fluorophenyl)hexyl 2-(2-methylsulfanyl-4-oxoazetidin-1-yl)acetate |
|---|---|
| PubChem CID | 54089051 |
| Molecular Formula | C18H24FNO3S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 6-(4-fluorophenyl)hexyl 2-(2-methylsulfanyl-4-oxoazetidin-1-yl)acetate |
| SMILES | CSC1CC(=O)N1CC(=O)OCCCCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNO3S/c1-24-17-12-16(21)20(17)13-18(22)23-11-5-3-2-4-6-14-7-9-15(19)10-8-14/h7-10,17H,2-6,11-13H2,1H3 |
| InChIKey | MSOIWWRLOJMVSO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|