C28H34FNO5S — CID 142642819
prop-2-enyl 4-[[1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate (PubChem CID 142642819) has the molecular formula C28H34FNO5S and a molecular weight of 515.65 g/mol. Its IUPAC name is prop-2-enyl 4-[[1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate.
| Compound Name | prop-2-enyl 4-[[1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate |
|---|---|
| PubChem CID | 142642819 |
| Molecular Formula | C28H34FNO5S |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | prop-2-enyl 4-[[1-[2-[6-(4-fluorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(CS(=O)C2CC(=O)N2CCOCCCCCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H34FNO5S/c1-2-17-35-28(32)24-12-8-23(9-13-24)21-36(33)27-20-26(31)30(27)16-19-34-18-6-4-3-5-7-22-10-14-25(29)15-11-22/h2,8-15,27H,1,3-7,16-21H2 |
| InChIKey | MFARULHKIMWQHI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|