C30H34O6 — CID 10917976
prop-2-enyl 4-[2-hydroxy-3-[4-(5-phenylpentoxy)phenoxy]propoxy]benzoate (PubChem CID 10917976) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is prop-2-enyl 4-[2-hydroxy-3-[4-(5-phenylpentoxy)phenoxy]propoxy]benzoate.
| Compound Name | prop-2-enyl 4-[2-hydroxy-3-[4-(5-phenylpentoxy)phenoxy]propoxy]benzoate |
|---|---|
| PubChem CID | 10917976 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | prop-2-enyl 4-[2-hydroxy-3-[4-(5-phenylpentoxy)phenoxy]propoxy]benzoate |
| SMILES | C=CCOC(=O)c1ccc(OCC(O)COc2ccc(OCCCCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H34O6/c1-2-20-34-30(32)25-12-14-28(15-13-25)35-22-26(31)23-36-29-18-16-27(17-19-29)33-21-8-4-7-11-24-9-5-3-6-10-24/h2-3,5-6,9-10,12-19,26,31H,1,4,7-8,11,20-23H2 |
| InChIKey | QSVSNTIGOBTXFM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|