C28H34ClNO5S — CID 54394447
prop-2-enyl 4-[[1-[2-[2-(2-chlorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate (PubChem CID 54394447) has the molecular formula C28H34ClNO5S and a molecular weight of 532.10 g/mol. Its IUPAC name is prop-2-enyl 4-[[1-[2-[2-(2-chlorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate.
| Compound Name | prop-2-enyl 4-[[1-[2-[2-(2-chlorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate |
|---|---|
| PubChem CID | 54394447 |
| Molecular Formula | C28H34ClNO5S |
| Molecular Weight | 532.10 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | prop-2-enyl 4-[[1-[2-[2-(2-chlorophenyl)hexoxy]ethyl]-4-oxoazetidin-2-yl]sulfinylmethyl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(CS(=O)C2CC(=O)N2CCOCC(CCCC)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C28H34ClNO5S/c1-3-5-8-23(24-9-6-7-10-25(24)29)19-34-17-15-30-26(31)18-27(30)36(33)20-21-11-13-22(14-12-21)28(32)35-16-4-2/h4,6-7,9-14,23,27H,2-3,5,8,15-20H2,1H3 |
| InChIKey | VIYCJAVTBNRPKQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.10 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|