C29H35FN2O5S — CID 139835318
prop-2-enyl 4-[[1-[1-[6-(4-fluorophenyl)hexylamino]-1-oxopropan-2-yl]-2-oxoazetidin-3-yl]sulfinylmethyl]benzoate (PubChem CID 139835318) has the molecular formula C29H35FN2O5S and a molecular weight of 542.67 g/mol. Its IUPAC name is prop-2-enyl 4-[[1-[1-[6-(4-fluorophenyl)hexylamino]-1-oxopropan-2-yl]-2-oxoazetidin-3-yl]sulfinylmethyl]benzoate.
| Compound Name | prop-2-enyl 4-[[1-[1-[6-(4-fluorophenyl)hexylamino]-1-oxopropan-2-yl]-2-oxoazetidin-3-yl]sulfinylmethyl]benzoate |
|---|---|
| PubChem CID | 139835318 |
| Molecular Formula | C29H35FN2O5S |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | prop-2-enyl 4-[[1-[1-[6-(4-fluorophenyl)hexylamino]-1-oxopropan-2-yl]-2-oxoazetidin-3-yl]sulfinylmethyl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(CS(=O)C2CN(C(C)C(=O)NCCCCCCc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H35FN2O5S/c1-3-18-37-29(35)24-13-9-23(10-14-24)20-38(36)26-19-32(28(26)34)21(2)27(33)31-17-7-5-4-6-8-22-11-15-25(30)16-12-22/h3,9-16,21,26H,1,4-8,17-20H2,2H3,(H,31,33) |
| InChIKey | RDJOARLIADNPEX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|