C27H39FN6O5 — CID 58888764
prop-2-enyl N-[3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-pentan-3-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 58888764) has the molecular formula C27H39FN6O5 and a molecular weight of 546.64 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-pentan-3-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-pentan-3-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 58888764 |
| Molecular Formula | C27H39FN6O5 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | prop-2-enyl N-[3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-pentan-3-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(C(CC)CC)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H39FN6O5/c1-5-15-39-27(38)29-14-8-9-22-25(36)32(21(6-2)7-3)17-23-33(22)24(35)18-31(4)34(23)26(37)30-16-19-10-12-20(28)13-11-19/h5,10-13,21-23H,1,6-9,14-18H2,2-4H3,(H,29,38)(H,30,37)/t22-,23-/m0/s1 |
| InChIKey | HYWMAVCSPINWRT-GOTSBHOMSA-N |
| XLogP | 2.44 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|