C31H40N6O7 — CID 58888184
prop-2-enyl N-[3-[(6S,9aS)-8-[(4-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 58888184) has the molecular formula C31H40N6O7 and a molecular weight of 608.70 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S,9aS)-8-[(4-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S,9aS)-8-[(4-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 58888184 |
| Molecular Formula | C31H40N6O7 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | prop-2-enyl N-[3-[(6S,9aS)-8-[(4-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(Cc2ccc(OC)cc2)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H40N6O7/c1-5-17-44-31(41)32-16-6-7-26-29(39)35(19-23-10-14-25(43-4)15-11-23)20-27-36(26)28(38)21-34(2)37(27)30(40)33-18-22-8-12-24(42-3)13-9-22/h5,8-15,26-27H,1,6-7,16-21H2,2-4H3,(H,32,41)(H,33,40)/t26-,27-/m0/s1 |
| InChIKey | QZZTYCSOILQZLD-SVBPBHIXSA-N |
| XLogP | 2.33 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|