C28H40N6O7 — CID 142956486
prop-2-enyl N-[3-[(6S)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 142956486) has the molecular formula C28H40N6O7 and a molecular weight of 572.66 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142956486 |
| Molecular Formula | C28H40N6O7 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | prop-2-enyl N-[3-[(6S)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(CC2CCCO2)CC2N1C(=O)CN(C)N2C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H40N6O7/c1-4-14-41-28(38)29-13-5-8-23-26(36)32(17-22-7-6-15-40-22)18-24-33(23)25(35)19-31(2)34(24)27(37)30-16-20-9-11-21(39-3)12-10-20/h4,9-12,22-24H,1,5-8,13-19H2,2-3H3,(H,29,38)(H,30,37)/t22?,23-,24?/m0/s1 |
| InChIKey | BGMKOFCRNHWAQY-WLXPTCNVSA-N |
| XLogP | 1.30 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|