C28H40N6O6 — CID 70640721
prop-2-enyl N-[3-[(6S,9aS)-1-(benzylcarbamoyl)-2-ethyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 70640721) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S,9aS)-1-(benzylcarbamoyl)-2-ethyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S,9aS)-1-(benzylcarbamoyl)-2-ethyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 70640721 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | prop-2-enyl N-[3-[(6S,9aS)-1-(benzylcarbamoyl)-2-ethyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(CC2CCCO2)C[C@H]2N1C(=O)CN(CC)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H40N6O6/c1-3-15-40-28(38)29-14-8-13-23-26(36)31(18-22-12-9-16-39-22)19-24-33(23)25(35)20-32(4-2)34(24)27(37)30-17-21-10-6-5-7-11-21/h3,5-7,10-11,22-24H,1,4,8-9,12-20H2,2H3,(H,29,38)(H,30,37)/t22?,23-,24-/m0/s1 |
| InChIKey | FOPIYCJIQFJOIF-VYCPFJESSA-N |
| XLogP | 1.69 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|