C23H31N5O4 — CID 142955768
(6S)-N-benzyl-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-6-prop-1-en-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 142955768) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (6S)-N-benzyl-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-6-prop-1-en-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-N-benzyl-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-6-prop-1-en-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 142955768 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (6S)-N-benzyl-2-methyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-6-prop-1-en-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=C(C)[C@H]1C(=O)N(CC2CCCO2)CC2N1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H31N5O4/c1-16(2)21-22(30)26(13-18-10-7-11-32-18)14-19-27(21)20(29)15-25(3)28(19)23(31)24-12-17-8-5-4-6-9-17/h4-6,8-9,18-19,21H,1,7,10-15H2,2-3H3,(H,24,31)/t18?,19?,21-/m0/s1 |
| InChIKey | KEKKPIWBRQGODL-GRERDSQWSA-N |
| XLogP | 1.18 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|