C29H37N6O5P — CID 142956441
prop-2-enyl N-[3-[(6S)-8-benzyl-2-methyl-4,7-dioxo-1-[(4-phosphanylphenyl)methylcarbamoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 142956441) has the molecular formula C29H37N6O5P and a molecular weight of 580.63 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S)-8-benzyl-2-methyl-4,7-dioxo-1-[(4-phosphanylphenyl)methylcarbamoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S)-8-benzyl-2-methyl-4,7-dioxo-1-[(4-phosphanylphenyl)methylcarbamoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142956441 |
| Molecular Formula | C29H37N6O5P |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | prop-2-enyl N-[3-[(6S)-8-benzyl-2-methyl-4,7-dioxo-1-[(4-phosphanylphenyl)methylcarbamoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(Cc2ccccc2)CC2N1C(=O)CN(C)N2C(=O)NCc1ccc(P)cc1 |
| InChI | InChI=1S/C29H37N6O5P/c1-3-16-40-29(39)30-15-7-10-24-27(37)33(18-22-8-5-4-6-9-22)19-25-34(24)26(36)20-32(2)35(25)28(38)31-17-21-11-13-23(41)14-12-21/h3-6,8-9,11-14,24-25H,1,7,10,15-20,41H2,2H3,(H,30,39)(H,31,38)/t24-,25?/m0/s1 |
| InChIKey | HBMGAMUERGOYLF-SKCDSABHSA-N |
| XLogP | 1.82 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|