C38H46N6O5 — CID 58888598
prop-2-enyl N-[3-[(6S,9aS)-8-(3,3-diphenylpropyl)-2-methyl-1-[(4-methylphenyl)methylcarbamoyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 58888598) has the molecular formula C38H46N6O5 and a molecular weight of 666.82 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S,9aS)-8-(3,3-diphenylpropyl)-2-methyl-1-[(4-methylphenyl)methylcarbamoyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S,9aS)-8-(3,3-diphenylpropyl)-2-methyl-1-[(4-methylphenyl)methylcarbamoyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 58888598 |
| Molecular Formula | C38H46N6O5 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | prop-2-enyl N-[3-[(6S,9aS)-8-(3,3-diphenylpropyl)-2-methyl-1-[(4-methylphenyl)methylcarbamoyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(CCC(c2ccccc2)c2ccccc2)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C38H46N6O5/c1-4-24-49-38(48)39-22-11-16-33-36(46)42(23-21-32(30-12-7-5-8-13-30)31-14-9-6-10-15-31)26-34-43(33)35(45)27-41(3)44(34)37(47)40-25-29-19-17-28(2)18-20-29/h4-10,12-15,17-20,32-34H,1,11,16,21-27H2,2-3H3,(H,39,48)(H,40,47)/t33-,34-/m0/s1 |
| InChIKey | MLUDVWYTPOEPGV-HEVIKAOCSA-N |
| XLogP | 4.65 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|