C29H34ClFN6O5 — CID 143145855
prop-2-enyl N-[3-[(6S)-8-[(2-chlorophenyl)methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 143145855) has the molecular formula C29H34ClFN6O5 and a molecular weight of 601.08 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S)-8-[(2-chlorophenyl)methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S)-8-[(2-chlorophenyl)methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 143145855 |
| Molecular Formula | C29H34ClFN6O5 |
| Molecular Weight | 601.08 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | prop-2-enyl N-[3-[(6S)-8-[(2-chlorophenyl)methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(Cc2ccccc2Cl)CC2N1C(=O)CN(C)N2C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C29H34ClFN6O5/c1-3-15-42-29(41)32-14-6-9-24-27(39)35(17-21-7-4-5-8-23(21)30)18-25-36(24)26(38)19-34(2)37(25)28(40)33-16-20-10-12-22(31)13-11-20/h3-5,7-8,10-13,24-25H,1,6,9,14-19H2,2H3,(H,32,41)(H,33,40)/t24-,25?/m0/s1 |
| InChIKey | KPSVKDVGTNEGLS-SKCDSABHSA-N |
| XLogP | 3.11 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.08 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|