C28H27ClFN5O3 — CID 58889919
(6S,9aS)-8-[(2-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58889919) has the molecular formula C28H27ClFN5O3 and a molecular weight of 536.01 g/mol. Its IUPAC name is (6S,9aS)-8-[(2-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-8-[(2-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58889919 |
| Molecular Formula | C28H27ClFN5O3 |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (6S,9aS)-8-[(2-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3ccccc3Cl)C[C@@H]2N1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H27ClFN5O3/c1-32-18-25(36)34-24(35(32)28(38)31-15-19-11-13-22(30)14-12-19)17-33(16-21-9-5-6-10-23(21)29)27(37)26(34)20-7-3-2-4-8-20/h2-14,24,26H,15-18H2,1H3,(H,31,38)/t24-,26-/m0/s1 |
| InChIKey | TVCJVXBSTYXQGK-AHWVRZQESA-N |
| XLogP | 3.79 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |