C24H26FN5O5 — CID 58888638
2-[(6S,9aS)-8-benzyl-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid (PubChem CID 58888638) has the molecular formula C24H26FN5O5 and a molecular weight of 483.50 g/mol. Its IUPAC name is 2-[(6S,9aS)-8-benzyl-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid.
| Compound Name | 2-[(6S,9aS)-8-benzyl-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 58888638 |
| Molecular Formula | C24H26FN5O5 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 2-[(6S,9aS)-8-benzyl-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
| SMILES | CN1CC(=O)N2[C@@H](CC(=O)O)C(=O)N(Cc3ccccc3)C[C@@H]2N1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN5O5/c1-27-15-21(31)29-19(11-22(32)33)23(34)28(13-17-5-3-2-4-6-17)14-20(29)30(27)24(35)26-12-16-7-9-18(25)10-8-16/h2-10,19-20H,11-15H2,1H3,(H,26,35)(H,32,33)/t19-,20-/m0/s1 |
| InChIKey | HAHZANPVZUNJRL-PMACEKPBSA-N |
| XLogP | 1.24 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |