C26H28FI2N5O5 — CID 89383253
2-[(6S,9aS)-8-[[3,4-bis(iodomethyl)phenyl]methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid (PubChem CID 89383253) has the molecular formula C26H28FI2N5O5 and a molecular weight of 763.35 g/mol. Its IUPAC name is 2-[(6S,9aS)-8-[[3,4-bis(iodomethyl)phenyl]methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid.
| Compound Name | 2-[(6S,9aS)-8-[[3,4-bis(iodomethyl)phenyl]methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 89383253 |
| Molecular Formula | C26H28FI2N5O5 |
| Molecular Weight | 763.35 g/mol |
| Exact Mass | 763.02 |
| IUPAC Name | 2-[(6S,9aS)-8-[[3,4-bis(iodomethyl)phenyl]methyl]-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
| SMILES | CN1CC(=O)N2[C@@H](CC(=O)O)C(=O)N(Cc3ccc(CI)c(CI)c3)C[C@@H]2N1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FI2N5O5/c1-31-15-23(35)33-21(9-24(36)37)25(38)32(13-17-2-5-18(10-28)19(8-17)11-29)14-22(33)34(31)26(39)30-12-16-3-6-20(27)7-4-16/h2-8,21-22H,9-15H2,1H3,(H,30,39)(H,36,37)/t21-,22-/m0/s1 |
| InChIKey | OBJXDWWDYVMXGU-VXKWHMMOSA-N |
| XLogP | 3.11 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|