C25H28FN5O5 — CID 58888635
3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid (PubChem CID 58888635) has the molecular formula C25H28FN5O5 and a molecular weight of 497.53 g/mol. Its IUPAC name is 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid.
| Compound Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 58888635 |
| Molecular Formula | C25H28FN5O5 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
| SMILES | CN1CC(=O)N2[C@@H](CCC(=O)O)C(=O)N(Cc3ccc(F)cc3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H28FN5O5/c1-28-16-22(32)30-20(11-12-23(33)34)24(35)29(14-18-7-9-19(26)10-8-18)15-21(30)31(28)25(36)27-13-17-5-3-2-4-6-17/h2-10,20-21H,11-16H2,1H3,(H,27,36)(H,33,34)/t20-,21-/m0/s1 |
| InChIKey | SVEAFSWPYYIGCZ-SFTDATJTSA-N |
| XLogP | 1.63 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |