C25H33N5O6 — CID 143145724
3-[(6S,9aS)-1-(benzylcarbamoyl)-8-(furan-2-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid;ethane (PubChem CID 143145724) has the molecular formula C25H33N5O6 and a molecular weight of 499.57 g/mol. Its IUPAC name is 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-(furan-2-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid;ethane.
| Compound Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-(furan-2-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid;ethane |
|---|---|
| PubChem CID | 143145724 |
| Molecular Formula | C25H33N5O6 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-(furan-2-ylmethyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid;ethane |
| SMILES | CC.CN1CC(=O)N2[C@@H](CCC(=O)O)C(=O)N(Cc3ccco3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H27N5O6.C2H6/c1-25-15-20(29)27-18(9-10-21(30)31)22(32)26(13-17-8-5-11-34-17)14-19(27)28(25)23(33)24-12-16-6-3-2-4-7-16;1-2/h2-8,11,18-19H,9-10,12-15H2,1H3,(H,24,33)(H,30,31);1-2H3/t18-,19-;/m0./s1 |
| InChIKey | PAXXAKXLYCFRLB-HLRBRJAUSA-N |
| XLogP | 2.11 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |