C25H30ClN5O3 — CID 58888946
(6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58888946) has the molecular formula C25H30ClN5O3 and a molecular weight of 484.00 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58888946 |
| Molecular Formula | C25H30ClN5O3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCC[C@H]1C(=O)N(Cc2ccccc2Cl)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H30ClN5O3/c1-3-9-21-24(33)29(15-19-12-7-8-13-20(19)26)16-22-30(21)23(32)17-28(2)31(22)25(34)27-14-18-10-5-4-6-11-18/h4-8,10-13,21-22H,3,9,14-17H2,1-2H3,(H,27,34)/t21-,22-/m0/s1 |
| InChIKey | ULPZRBAJRKALGU-VXKWHMMOSA-N |
| XLogP | 3.08 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |