C25H29ClFN5O3S — CID 71218771
(6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-(fluoromethyl)-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 71218771) has the molecular formula C25H29ClFN5O3S and a molecular weight of 534.06 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-(fluoromethyl)-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-(fluoromethyl)-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 71218771 |
| Molecular Formula | C25H29ClFN5O3S |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(2-chlorophenyl)methyl]-2-(fluoromethyl)-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CSCC[C@H]1C(=O)N(Cc2ccccc2Cl)C[C@H]2N1C(=O)CN(CF)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H29ClFN5O3S/c1-36-12-11-21-24(34)29(14-19-9-5-6-10-20(19)26)15-22-31(21)23(33)16-30(17-27)32(22)25(35)28-13-18-7-3-2-4-8-18/h2-10,21-22H,11-17H2,1H3,(H,28,35)/t21-,22-/m0/s1 |
| InChIKey | JLQBRQQDKBZCRC-VXKWHMMOSA-N |
| XLogP | 3.33 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|