C27H33Cl2N5O3 — CID 70640870
(6S,9aS)-N-benzyl-6-butyl-8-[(2,4-dichlorophenyl)methyl]-2-ethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 70640870) has the molecular formula C27H33Cl2N5O3 and a molecular weight of 546.50 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-butyl-8-[(2,4-dichlorophenyl)methyl]-2-ethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-butyl-8-[(2,4-dichlorophenyl)methyl]-2-ethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 70640870 |
| Molecular Formula | C27H33Cl2N5O3 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-butyl-8-[(2,4-dichlorophenyl)methyl]-2-ethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCC[C@H]1C(=O)N(Cc2ccc(Cl)cc2Cl)C[C@H]2N1C(=O)CN(CC)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H33Cl2N5O3/c1-3-5-11-23-26(36)31(16-20-12-13-21(28)14-22(20)29)17-24-33(23)25(35)18-32(4-2)34(24)27(37)30-15-19-9-7-6-8-10-19/h6-10,12-14,23-24H,3-5,11,15-18H2,1-2H3,(H,30,37)/t23-,24-/m0/s1 |
| InChIKey | SBMGIAWOZGQIGJ-ZEQRLZLVSA-N |
| XLogP | 4.51 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |