C28H36FN5O3 — CID 70640954
(6S,9aS)-N-benzyl-6-butyl-2-ethyl-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 70640954) has the molecular formula C28H36FN5O3 and a molecular weight of 509.63 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-butyl-2-ethyl-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-butyl-2-ethyl-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 70640954 |
| Molecular Formula | C28H36FN5O3 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-butyl-2-ethyl-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCC[C@H]1C(=O)N(CCc2ccc(F)cc2)C[C@H]2N1C(=O)CN(CC)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H36FN5O3/c1-3-5-11-24-27(36)31(17-16-21-12-14-23(29)15-13-21)19-25-33(24)26(35)20-32(4-2)34(25)28(37)30-18-22-9-7-6-8-10-22/h6-10,12-15,24-25H,3-5,11,16-20H2,1-2H3,(H,30,37)/t24-,25-/m0/s1 |
| InChIKey | PSQJSJBYIPVKST-DQEYMECFSA-N |
| XLogP | 3.39 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |