C30H41FN6O3 — CID 71218924
(6S,9aS)-8-(6-aminohexyl)-6-benzyl-N-[(4-fluorophenyl)methyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 71218924) has the molecular formula C30H41FN6O3 and a molecular weight of 552.70 g/mol. Its IUPAC name is (6S,9aS)-8-(6-aminohexyl)-6-benzyl-N-[(4-fluorophenyl)methyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-8-(6-aminohexyl)-6-benzyl-N-[(4-fluorophenyl)methyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 71218924 |
| Molecular Formula | C30H41FN6O3 |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | (6S,9aS)-8-(6-aminohexyl)-6-benzyl-N-[(4-fluorophenyl)methyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCN1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(CCCCCCN)C[C@@H]2N1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C30H41FN6O3/c1-2-17-35-22-28(38)36-26(19-23-10-6-5-7-11-23)29(39)34(18-9-4-3-8-16-32)21-27(36)37(35)30(40)33-20-24-12-14-25(31)15-13-24/h5-7,10-15,26-27H,2-4,8-9,16-22,32H2,1H3,(H,33,40)/t26-,27-/m0/s1 |
| InChIKey | CRTQHSMYJHPXLW-SVBPBHIXSA-N |
| XLogP | 3.11 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|