C37H38FN5O3 — CID 58888446
(6S,9aS)-6-benzyl-8-(3,3-diphenylpropyl)-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58888446) has the molecular formula C37H38FN5O3 and a molecular weight of 619.74 g/mol. Its IUPAC name is (6S,9aS)-6-benzyl-8-(3,3-diphenylpropyl)-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-6-benzyl-8-(3,3-diphenylpropyl)-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58888446 |
| Molecular Formula | C37H38FN5O3 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | (6S,9aS)-6-benzyl-8-(3,3-diphenylpropyl)-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(CCC(c3ccccc3)c3ccccc3)C[C@@H]2N1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C37H38FN5O3/c1-40-26-35(44)42-33(23-27-11-5-2-6-12-27)36(45)41(22-21-32(29-13-7-3-8-14-29)30-15-9-4-10-16-30)25-34(42)43(40)37(46)39-24-28-17-19-31(38)20-18-28/h2-20,32-34H,21-26H2,1H3,(H,39,46)/t33-,34-/m0/s1 |
| InChIKey | KDKMFBHFYWMARQ-HEVIKAOCSA-N |
| XLogP | 5.03 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |