C27H35N5O4 — CID 70640925
(6S,9aS)-N-benzyl-8-butyl-2-ethyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 70640925) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-butyl-2-ethyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-butyl-2-ethyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 70640925 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-butyl-2-ethyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCCN1C[C@H]2N(C(=O)CN(CC)N2C(=O)NCc2ccccc2)[C@@H](Cc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C27H35N5O4/c1-3-5-15-29-18-24-31(23(26(29)35)16-20-11-13-22(33)14-12-20)25(34)19-30(4-2)32(24)27(36)28-17-21-9-7-6-8-10-21/h6-14,23-24,33H,3-5,15-19H2,1-2H3,(H,28,36)/t23-,24-/m0/s1 |
| InChIKey | ZUGIOWUQUQXDDE-ZEQRLZLVSA-N |
| XLogP | 2.56 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |