C28H49N5O3 — CID 142956181
(6S)-N-benzyl-8-butyl-2-ethyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane (PubChem CID 142956181) has the molecular formula C28H49N5O3 and a molecular weight of 503.73 g/mol. Its IUPAC name is (6S)-N-benzyl-8-butyl-2-ethyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane.
| Compound Name | (6S)-N-benzyl-8-butyl-2-ethyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane |
|---|---|
| PubChem CID | 142956181 |
| Molecular Formula | C28H49N5O3 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.38 |
| IUPAC Name | (6S)-N-benzyl-8-butyl-2-ethyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane |
| SMILES | CC.CC.CCCCN1CC2N(C(=O)CN(CC)N2C(=O)NCc2ccccc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C24H37N5O3.2C2H6/c1-5-7-13-26-16-21-28(20(23(26)31)14-18(3)4)22(30)17-27(6-2)29(21)24(32)25-15-19-11-9-8-10-12-19;2*1-2/h8-12,18,20-21H,5-7,13-17H2,1-4H3,(H,25,32);2*1-2H3/t20-,21?;;/m0../s1 |
| InChIKey | ABUNMMWBCFQBDM-OAQMNXJYSA-N |
| XLogP | 4.71 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |