C24H37N5O3 — CID 70640819
(6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 70640819) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 70640819 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCC(C)[C@H]1C(=O)N(CC(C)C)C[C@H]2N1C(=O)CN(CC)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H37N5O3/c1-6-18(5)22-23(31)26(14-17(3)4)15-20-28(22)21(30)16-27(7-2)29(20)24(32)25-13-19-11-9-8-10-12-19/h8-12,17-18,20,22H,6-7,13-16H2,1-5H3,(H,25,32)/t18?,20-,22-/m0/s1 |
| InChIKey | UHYOZOCGDILPQN-KAOUJKNGSA-N |
| XLogP | 2.52 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |