C29H34FN5O3 — CID 87151229
N-benzyl-6-[(2S)-butan-2-yl]-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 87151229) has the molecular formula C29H34FN5O3 and a molecular weight of 519.62 g/mol. Its IUPAC name is N-benzyl-6-[(2S)-butan-2-yl]-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-6-[(2S)-butan-2-yl]-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 87151229 |
| Molecular Formula | C29H34FN5O3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | N-benzyl-6-[(2S)-butan-2-yl]-8-[2-(4-fluorophenyl)ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2C([C@@H](C)CC)C(=O)N(CCc3ccc(F)cc3)CC2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H34FN5O3/c1-4-16-33-20-26(36)34-25(35(33)29(38)31-18-23-9-7-6-8-10-23)19-32(28(37)27(34)21(3)5-2)17-15-22-11-13-24(30)14-12-22/h1,6-14,21,25,27H,5,15-20H2,2-3H3,(H,31,38)/t21-,25?,27?/m0/s1 |
| InChIKey | XQNNKOKTXJBPEK-WSFMRIJLSA-N |
| XLogP | 2.86 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|