C27H34FN5O3 — CID 71218707
(6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 71218707) has the molecular formula C27H34FN5O3 and a molecular weight of 495.60 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 71218707 |
| Molecular Formula | C27H34FN5O3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-butan-2-yl-2-ethyl-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCC(C)[C@H]1C(=O)N(Cc2ccc(F)cc2)C[C@H]2N1C(=O)CN(CC)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H34FN5O3/c1-4-19(3)25-26(35)30(16-21-11-13-22(28)14-12-21)17-23-32(25)24(34)18-31(5-2)33(23)27(36)29-15-20-9-7-6-8-10-20/h6-14,19,23,25H,4-5,15-18H2,1-3H3,(H,29,36)/t19?,23-,25-/m0/s1 |
| InChIKey | BNUAJLGMNSTWCF-DTFKUICFSA-N |
| XLogP | 3.20 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |