C28H37N5O5 — CID 58887837
(6S,9aS)-6-butan-2-yl-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58887837) has the molecular formula C28H37N5O5 and a molecular weight of 523.63 g/mol. Its IUPAC name is (6S,9aS)-6-butan-2-yl-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-6-butan-2-yl-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58887837 |
| Molecular Formula | C28H37N5O5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | (6S,9aS)-6-butan-2-yl-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCC(C)[C@H]1C(=O)N(Cc2ccc(OC)cc2)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H37N5O5/c1-6-19(2)26-27(35)31(16-21-9-13-23(38-5)14-10-21)17-24-32(26)25(34)18-30(3)33(24)28(36)29-15-20-7-11-22(37-4)12-8-20/h7-14,19,24,26H,6,15-18H2,1-5H3,(H,29,36)/t19?,24-,26-/m0/s1 |
| InChIKey | LZDDJQKDVCQPPQ-HFKVKABFSA-N |
| XLogP | 2.69 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |