C27H35N5O5 — CID 58887688
(6S,9aS)-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58887688) has the molecular formula C27H35N5O5 and a molecular weight of 509.61 g/mol. Its IUPAC name is (6S,9aS)-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58887688 |
| Molecular Formula | C27H35N5O5 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (6S,9aS)-N,8-bis[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2[C@H]3CN(Cc4ccc(OC)cc4)C(=O)[C@H](C(C)C)N3C(=O)CN2C)cc1 |
| InChI | InChI=1S/C27H35N5O5/c1-18(2)25-26(34)30(15-20-8-12-22(37-5)13-9-20)16-23-31(25)24(33)17-29(3)32(23)27(35)28-14-19-6-10-21(36-4)11-7-19/h6-13,18,23,25H,14-17H2,1-5H3,(H,28,35)/t23-,25-/m0/s1 |
| InChIKey | WTQUYUFZHNPPJX-ZCYQVOJMSA-N |
| XLogP | 2.30 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |