C26H32FN5O4 — CID 142956260
(6S)-8-[(4-fluorophenyl)methyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 142956260) has the molecular formula C26H32FN5O4 and a molecular weight of 497.57 g/mol. Its IUPAC name is (6S)-8-[(4-fluorophenyl)methyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-8-[(4-fluorophenyl)methyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 142956260 |
| Molecular Formula | C26H32FN5O4 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (6S)-8-[(4-fluorophenyl)methyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCC[C@H]1C(=O)N(Cc2ccc(F)cc2)CC2N1C(=O)CN(C)N2C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H32FN5O4/c1-4-5-22-25(34)30(15-19-6-10-20(27)11-7-19)16-23-31(22)24(33)17-29(2)32(23)26(35)28-14-18-8-12-21(36-3)13-9-18/h6-13,22-23H,4-5,14-17H2,1-3H3,(H,28,35)/t22-,23?/m0/s1 |
| InChIKey | PZUPYDRSDCIZEW-NQCNTLBGSA-N |
| XLogP | 2.57 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |