C24H37N5O5 — CID 143145710
(6S)-6-butyl-N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145710) has the molecular formula C24H37N5O5 and a molecular weight of 475.59 g/mol. Its IUPAC name is (6S)-6-butyl-N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-6-butyl-N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145710 |
| Molecular Formula | C24H37N5O5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (6S)-6-butyl-N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCC[C@H]1C(=O)N(CCCOC)CC2N1C(=O)CN(C)N2C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H37N5O5/c1-5-6-8-20-23(31)27(13-7-14-33-3)16-21-28(20)22(30)17-26(2)29(21)24(32)25-15-18-9-11-19(34-4)12-10-18/h9-12,20-21H,5-8,13-17H2,1-4H3,(H,25,32)/t20-,21?/m0/s1 |
| InChIKey | ZYRDPURIQGMPLV-BGERDNNASA-N |
| XLogP | 1.66 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|