C22H34N6O4 — CID 143145394
(6S)-N-benzyl-8-(2-methoxyethyl)-2-methyl-6-[3-(methylamino)propyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145394) has the molecular formula C22H34N6O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is (6S)-N-benzyl-8-(2-methoxyethyl)-2-methyl-6-[3-(methylamino)propyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-N-benzyl-8-(2-methoxyethyl)-2-methyl-6-[3-(methylamino)propyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145394 |
| Molecular Formula | C22H34N6O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (6S)-N-benzyl-8-(2-methoxyethyl)-2-methyl-6-[3-(methylamino)propyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CNCCC[C@H]1C(=O)N(CCOC)CC2N1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H34N6O4/c1-23-11-7-10-18-21(30)26(12-13-32-3)15-19-27(18)20(29)16-25(2)28(19)22(31)24-14-17-8-5-4-6-9-17/h4-6,8-9,18-19,23H,7,10-16H2,1-3H3,(H,24,31)/t18-,19?/m0/s1 |
| InChIKey | NIRUTRTVYXAJCL-OYKVQYDMSA-N |
| XLogP | 0.07 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|