C24H34IN5O5 — CID 143144842
(6S,9aS)-6-(3-iodopropyl)-8-(2-methoxyethyl)-2-methyl-4,7-dioxo-N-[(4-prop-1-en-2-yloxyphenyl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143144842) has the molecular formula C24H34IN5O5 and a molecular weight of 599.47 g/mol. Its IUPAC name is (6S,9aS)-6-(3-iodopropyl)-8-(2-methoxyethyl)-2-methyl-4,7-dioxo-N-[(4-prop-1-en-2-yloxyphenyl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-6-(3-iodopropyl)-8-(2-methoxyethyl)-2-methyl-4,7-dioxo-N-[(4-prop-1-en-2-yloxyphenyl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143144842 |
| Molecular Formula | C24H34IN5O5 |
| Molecular Weight | 599.47 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | (6S,9aS)-6-(3-iodopropyl)-8-(2-methoxyethyl)-2-methyl-4,7-dioxo-N-[(4-prop-1-en-2-yloxyphenyl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=C(C)Oc1ccc(CNC(=O)N2[C@H]3CN(CCOC)C(=O)[C@H](CCCI)N3C(=O)CN2C)cc1 |
| InChI | InChI=1S/C24H34IN5O5/c1-17(2)35-19-9-7-18(8-10-19)14-26-24(33)30-21-15-28(12-13-34-4)23(32)20(6-5-11-25)29(21)22(31)16-27(30)3/h7-10,20-21H,1,5-6,11-16H2,2-4H3,(H,26,33)/t20-,21-/m0/s1 |
| InChIKey | GZCKUVSFUWRBEE-SFTDATJTSA-N |
| XLogP | 2.20 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|