C23H35N5O5S — CID 66788590
N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 66788590) has the molecular formula C23H35N5O5S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 66788590 |
| Molecular Formula | C23H35N5O5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2-methyl-6-(2-methylsulfanylethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | COCCCN1CC2N(C(=O)CN(C)N2C(=O)NCc2ccc(OC)cc2)C(CCSC)C1=O |
| InChI | InChI=1S/C23H35N5O5S/c1-25-16-21(29)27-19(10-13-34-4)22(30)26(11-5-12-32-2)15-20(27)28(25)23(31)24-14-17-6-8-18(33-3)9-7-17/h6-9,19-20H,5,10-16H2,1-4H3,(H,24,31) |
| InChIKey | UWFPNQYLLWSGSH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|