C21H29N5O6 — CID 58887905
2-[(6S,9aS)-1-(benzylcarbamoyl)-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid (PubChem CID 58887905) has the molecular formula C21H29N5O6 and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-[(6S,9aS)-1-(benzylcarbamoyl)-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid.
| Compound Name | 2-[(6S,9aS)-1-(benzylcarbamoyl)-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 58887905 |
| Molecular Formula | C21H29N5O6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-[(6S,9aS)-1-(benzylcarbamoyl)-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
| SMILES | COCCCN1C[C@H]2N(C(=O)CN(C)N2C(=O)NCc2ccccc2)[C@@H](CC(=O)O)C1=O |
| InChI | InChI=1S/C21H29N5O6/c1-23-14-18(27)25-16(11-19(28)29)20(30)24(9-6-10-32-2)13-17(25)26(23)21(31)22-12-15-7-4-3-5-8-15/h3-5,7-8,16-17H,6,9-14H2,1-2H3,(H,22,31)(H,28,29)/t16-,17-/m0/s1 |
| InChIKey | HNPFQYXYZPGUHM-IRXDYDNUSA-N |
| XLogP | -0.06 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|