C27H33N5O6 — CID 58888637
2-[(6S,9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(3-phenylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid (PubChem CID 58888637) has the molecular formula C27H33N5O6 and a molecular weight of 523.59 g/mol. Its IUPAC name is 2-[(6S,9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(3-phenylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid.
| Compound Name | 2-[(6S,9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(3-phenylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 58888637 |
| Molecular Formula | C27H33N5O6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 2-[(6S,9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(3-phenylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
| SMILES | COc1ccc(CNC(=O)N2[C@H]3CN(CCCc4ccccc4)C(=O)[C@H](CC(=O)O)N3C(=O)CN2C)cc1 |
| InChI | InChI=1S/C27H33N5O6/c1-29-18-24(33)31-22(15-25(34)35)26(36)30(14-6-9-19-7-4-3-5-8-19)17-23(31)32(29)27(37)28-16-20-10-12-21(38-2)13-11-20/h3-5,7-8,10-13,22-23H,6,9,14-18H2,1-2H3,(H,28,37)(H,34,35)/t22-,23-/m0/s1 |
| InChIKey | NULSARWZLCJDRT-GOTSBHOMSA-N |
| XLogP | 1.54 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |