C21H31N5O5 — CID 142955869
N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2,6-dimethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 142955869) has the molecular formula C21H31N5O5 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2,6-dimethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2,6-dimethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 142955869 |
| Molecular Formula | C21H31N5O5 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-8-(3-methoxypropyl)-2,6-dimethyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | COCCCN1CC2N(C(=O)CN(C)N2C(=O)NCc2ccc(OC)cc2)C(C)C1=O |
| InChI | InChI=1S/C21H31N5O5/c1-15-20(28)24(10-5-11-30-3)13-18-25(15)19(27)14-23(2)26(18)21(29)22-12-16-6-8-17(31-4)9-7-16/h6-9,15,18H,5,10-14H2,1-4H3,(H,22,29) |
| InChIKey | VZNGRMUOTUSPGE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|