C23H34FN5O3 — CID 58889749
(6S,9aS)-N-[(4-fluorophenyl)methyl]-2-methyl-8-(3-methylbutyl)-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58889749) has the molecular formula C23H34FN5O3 and a molecular weight of 447.56 g/mol. Its IUPAC name is (6S,9aS)-N-[(4-fluorophenyl)methyl]-2-methyl-8-(3-methylbutyl)-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-[(4-fluorophenyl)methyl]-2-methyl-8-(3-methylbutyl)-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58889749 |
| Molecular Formula | C23H34FN5O3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (6S,9aS)-N-[(4-fluorophenyl)methyl]-2-methyl-8-(3-methylbutyl)-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCC[C@H]1C(=O)N(CCC(C)C)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H34FN5O3/c1-5-6-19-22(31)27(12-11-16(2)3)14-20-28(19)21(30)15-26(4)29(20)23(32)25-13-17-7-9-18(24)10-8-17/h7-10,16,19-20H,5-6,11-15H2,1-4H3,(H,25,32)/t19-,20-/m0/s1 |
| InChIKey | SRHOHJFTJYTGMA-PMACEKPBSA-N |
| XLogP | 2.41 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |