C28H36Cl2FN5O3 — CID 142956411
(6S)-6-butyl-8-[(3,4-dichlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane (PubChem CID 142956411) has the molecular formula C28H36Cl2FN5O3 and a molecular weight of 580.53 g/mol. Its IUPAC name is (6S)-6-butyl-8-[(3,4-dichlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane.
| Compound Name | (6S)-6-butyl-8-[(3,4-dichlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane |
|---|---|
| PubChem CID | 142956411 |
| Molecular Formula | C28H36Cl2FN5O3 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | (6S)-6-butyl-8-[(3,4-dichlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;ethane |
| SMILES | CC.CCCC[C@H]1C(=O)N(Cc2ccc(Cl)c(Cl)c2)CC2N1C(=O)CN(C)N2C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H30Cl2FN5O3.C2H6/c1-3-4-5-22-25(36)32(14-18-8-11-20(27)21(28)12-18)15-23-33(22)24(35)16-31(2)34(23)26(37)30-13-17-6-9-19(29)10-7-17;1-2/h6-12,22-23H,3-5,13-16H2,1-2H3,(H,30,37);1-2H3/t22-,23?;/m0./s1 |
| InChIKey | XDFYOLAZTHUFDH-OSMMWLIYSA-N |
| XLogP | 5.29 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |