C25H35N5O3S — CID 70640869
(6S,9aS)-N-benzyl-6-butan-2-yl-8-[2-(2,3-dihydrothiophen-2-yl)ethyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 70640869) has the molecular formula C25H35N5O3S and a molecular weight of 485.65 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-butan-2-yl-8-[2-(2,3-dihydrothiophen-2-yl)ethyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-butan-2-yl-8-[2-(2,3-dihydrothiophen-2-yl)ethyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 70640869 |
| Molecular Formula | C25H35N5O3S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-butan-2-yl-8-[2-(2,3-dihydrothiophen-2-yl)ethyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCC(C)[C@H]1C(=O)N(CCC2CC=CS2)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H35N5O3S/c1-4-18(2)23-24(32)28(13-12-20-11-8-14-34-20)16-21-29(23)22(31)17-27(3)30(21)25(33)26-15-19-9-6-5-7-10-19/h5-10,14,18,20-21,23H,4,11-13,15-17H2,1-3H3,(H,26,33)/t18?,20?,21-,23-/m0/s1 |
| InChIKey | AFGOHFNTXRBJAZ-JGAJYACASA-N |
| XLogP | 2.88 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |