C35H42N6O6 — CID 87451195
N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[[3-(methoxycarbamoyl)phenyl]methyl]-4,7-dioxo-2-pentyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 87451195) has the molecular formula C35H42N6O6 and a molecular weight of 642.76 g/mol. Its IUPAC name is N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[[3-(methoxycarbamoyl)phenyl]methyl]-4,7-dioxo-2-pentyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[[3-(methoxycarbamoyl)phenyl]methyl]-4,7-dioxo-2-pentyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 87451195 |
| Molecular Formula | C35H42N6O6 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[[3-(methoxycarbamoyl)phenyl]methyl]-4,7-dioxo-2-pentyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCCCN1CC(=O)N2C(Cc3ccc(O)cc3)C(=O)N(Cc3cccc(C(=O)NOC)c3)CC2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C35H42N6O6/c1-3-4-8-18-39-24-32(43)40-30(20-25-14-16-29(42)17-15-25)34(45)38(22-27-12-9-13-28(19-27)33(44)37-47-2)23-31(40)41(39)35(46)36-21-26-10-6-5-7-11-26/h5-7,9-17,19,30-31,42H,3-4,8,18,20-24H2,1-2H3,(H,36,46)(H,37,44) |
| InChIKey | NLLBQSQEASFUKF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|