C32H34N6O6 — CID 74438426
N-benzyl-8-[[3-(hydroxycarbamoyl)phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 74438426) has the molecular formula C32H34N6O6 and a molecular weight of 598.66 g/mol. Its IUPAC name is N-benzyl-8-[[3-(hydroxycarbamoyl)phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-8-[[3-(hydroxycarbamoyl)phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 74438426 |
| Molecular Formula | C32H34N6O6 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | N-benzyl-8-[[3-(hydroxycarbamoyl)phenyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2C(Cc3ccc(O)cc3)C(=O)N(Cc3cccc(C(=O)NO)c3)CC2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H34N6O6/c1-2-15-36-21-29(40)37-27(17-22-11-13-26(39)14-12-22)31(42)35(19-24-9-6-10-25(16-24)30(41)34-44)20-28(37)38(36)32(43)33-18-23-7-4-3-5-8-23/h2-14,16,27-28,39,44H,1,15,17-21H2,(H,33,43)(H,34,41) |
| InChIKey | CMOBCHKLQZKRRR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|