C31H32N5Na2O7P — CID 143145941
disodium;[4-[[(6S)-8-benzyl-1-(benzylcarbamoyl)-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] phosphate (PubChem CID 143145941) has the molecular formula C31H32N5Na2O7P and a molecular weight of 663.58 g/mol. Its IUPAC name is disodium;[4-[[(6S)-8-benzyl-1-(benzylcarbamoyl)-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] phosphate.
| Compound Name | disodium;[4-[[(6S)-8-benzyl-1-(benzylcarbamoyl)-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] phosphate |
|---|---|
| PubChem CID | 143145941 |
| Molecular Formula | C31H32N5Na2O7P |
| Molecular Weight | 663.58 g/mol |
| Exact Mass | 663.18 |
| IUPAC Name | disodium;[4-[[(6S)-8-benzyl-1-(benzylcarbamoyl)-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] phosphate |
| SMILES | C=CCN1CC(=O)N2C(CN(Cc3ccccc3)C(=O)[C@@H]2Cc2ccc(OP(=O)([O-])[O-])cc2)N1C(=O)NCc1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C31H34N5O7P.2Na/c1-2-17-34-22-29(37)35-27(18-23-13-15-26(16-14-23)43-44(40,41)42)30(38)33(20-25-11-7-4-8-12-25)21-28(35)36(34)31(39)32-19-24-9-5-3-6-10-24;;/h2-16,27-28H,1,17-22H2,(H,32,39)(H2,40,41,42);;/q;2*+1/p-2/t27-,28?;;/m0../s1 |
| InChIKey | RPVPRYQEMOVXGA-UMPSRTOWSA-L |
| XLogP | -4.36 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.58 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|