C31H31BrFN5O4 — CID 59204685
(6S,9aS)-N-benzyl-8-[(3-bromo-4-fluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59204685) has the molecular formula C31H31BrFN5O4 and a molecular weight of 636.52 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(3-bromo-4-fluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(3-bromo-4-fluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59204685 |
| Molecular Formula | C31H31BrFN5O4 |
| Molecular Weight | 636.52 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(3-bromo-4-fluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3ccc(F)c(Br)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C31H31BrFN5O4/c1-2-14-36-20-29(40)37-27(16-21-8-11-24(39)12-9-21)30(41)35(18-23-10-13-26(33)25(32)15-23)19-28(37)38(36)31(42)34-17-22-6-4-3-5-7-22/h2-13,15,27-28,39H,1,14,16-20H2,(H,34,42)/t27-,28-/m0/s1 |
| InChIKey | ODXPNYPCKQFYIZ-NSOVKSMOSA-N |
| XLogP | 4.03 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|