C32H35N5O6S — CID 59204802
(6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylsulfonylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59204802) has the molecular formula C32H35N5O6S and a molecular weight of 617.73 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylsulfonylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylsulfonylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59204802 |
| Molecular Formula | C32H35N5O6S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylsulfonylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3ccccc3S(C)(=O)=O)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H35N5O6S/c1-3-17-35-22-30(39)36-27(18-23-13-15-26(38)16-14-23)31(40)34(20-25-11-7-8-12-28(25)44(2,42)43)21-29(36)37(35)32(41)33-19-24-9-5-4-6-10-24/h3-16,27,29,38H,1,17-22H2,2H3,(H,33,41)/t27-,29-/m0/s1 |
| InChIKey | VBYGZBQMRRPMPU-YTMVLYRLSA-N |
| XLogP | 2.53 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|