C33H35N7O4 — CID 74438582
N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylindazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 74438582) has the molecular formula C33H35N7O4 and a molecular weight of 593.69 g/mol. Its IUPAC name is N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylindazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylindazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 74438582 |
| Molecular Formula | C33H35N7O4 |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(2-methylindazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2C(Cc3ccc(O)cc3)C(=O)N(Cc3cccc4cn(C)nc34)CC2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H35N7O4/c1-3-16-38-22-30(42)39-28(17-23-12-14-27(41)15-13-23)32(43)37(20-26-11-7-10-25-19-36(2)35-31(25)26)21-29(39)40(38)33(44)34-18-24-8-5-4-6-9-24/h3-15,19,28-29,41H,1,16-18,20-22H2,2H3,(H,34,44) |
| InChIKey | DJOPVTVIUVJAOK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|