C34H37N7O5 — CID 59567832
(6S,9aS)-N-benzyl-8-[(1,3-dimethyl-2-oxobenzimidazol-4-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59567832) has the molecular formula C34H37N7O5 and a molecular weight of 623.71 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(1,3-dimethyl-2-oxobenzimidazol-4-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(1,3-dimethyl-2-oxobenzimidazol-4-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59567832 |
| Molecular Formula | C34H37N7O5 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(1,3-dimethyl-2-oxobenzimidazol-4-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cccc4c3n(C)c(=O)n4C)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H37N7O5/c1-4-17-39-22-30(43)40-28(18-23-13-15-26(42)16-14-23)32(44)38(20-25-11-8-12-27-31(25)37(3)34(46)36(27)2)21-29(40)41(39)33(45)35-19-24-9-6-5-7-10-24/h4-16,28-29,42H,1,17-22H2,2-3H3,(H,35,45)/t28-,29-/m0/s1 |
| InChIKey | NEMNFRMAVVCQGN-VMPREFPWSA-N |
| XLogP | 2.32 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|